Pomolic acid 28-O-beta-D-glucopyranosyl ester structure
|
Common Name | Pomolic acid 28-O-beta-D-glucopyranosyl ester | ||
|---|---|---|---|---|
| CAS Number | 83725-24-0 | Molecular Weight | 634.84 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 726.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C36H58O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.1±26.4 °C | |
Use of Pomolic acid 28-O-beta-D-glucopyranosyl ester28-O-β-D-Glucopyranosyl pomolic acid is a urokinase plasminogen activator inhibitor with IC50 at 37.82 μM[1]. |
| Name | 1-O-[(3β)-3,19-Dihydroxy-28-oxours-12-en-28-yl]-β-D-glucopyranose |
|---|---|
| Synonym | More Synonyms |
| Description | 28-O-β-D-Glucopyranosyl pomolic acid is a urokinase plasminogen activator inhibitor with IC50 at 37.82 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 726.6±60.0 °C at 760 mmHg |
| Molecular Formula | C36H58O9 |
| Molecular Weight | 634.84 |
| Flash Point | 219.1±26.4 °C |
| Exact Mass | 634.408081 |
| PSA | 156.91000 |
| LogP | 6.73 |
| Vapour Pressure | 0.0±5.4 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | RRIMLWHUVCZACL-HPUCWRFUSA-N |
| SMILES | CC1CCC2(C(=O)OC3OC(CO)C(O)C(O)C3O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1(C)O |
| Hazard Codes | Xi |
|---|
| 1-O-[(3β)-3,19-Dihydroxy-28-oxours-12-en-28-yl]-β-D-glucopyranose |
| β-D-Glucopyranose, 1-O-[(3β)-3,19-dihydroxy-28-oxours-12-en-28-yl]- |
| Pomolic acid 28-O-beta-D-glucopyranosyl ester |
| Pomolic acid β-D-glucopyranosyl ester |