6-O-Feruloylglucose
Modify Date: 2025-08-30 16:51:26
6-O-Feruloylglucose structure
|
Common Name | 6-O-Feruloylglucose | ||
|---|---|---|---|---|
| CAS Number | 137887-25-3 | Molecular Weight | 356.32 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 684.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H20O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.5±25.0 °C | |
Use of 6-O-Feruloylglucose6-O-Feruloylglucose is a natural product that exhibits antioxidant activity[1][2]. |
| Name | 6-O-Feruloylglucose |
|---|---|
| Synonym | More Synonyms |
| Description | 6-O-Feruloylglucose is a natural product that exhibits antioxidant activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 684.7±55.0 °C at 760 mmHg |
| Molecular Formula | C16H20O9 |
| Molecular Weight | 356.32 |
| Flash Point | 250.5±25.0 °C |
| Exact Mass | 356.110718 |
| PSA | 145.91000 |
| LogP | -0.47 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | SQBITMSCIPALTP-HWKANZROSA-N |
| SMILES | COc1cc(C=CC(=O)OCC(O)C(O)C(O)C(O)C=O)ccc1O |
| Hazard Codes | Xi |
|---|
| D-Glucose, 6-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]- |
| 6-O-[(2E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoyl]-D-glucose |