SpinorphinTFA
Modify Date: 2025-10-03 15:49:22
SpinorphinTFA structure
|
Common Name | SpinorphinTFA | ||
|---|---|---|---|---|
| CAS Number | 137201-62-8 | Molecular Weight | 877.03700 | |
| Density | 1.277g/cm3 | Boiling Point | 1256.3ºC at 760 mmHg | |
| Molecular Formula | C45H64N8O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 713.6ºC | |
Use of SpinorphinTFASpinorphin is an inhibitor of enkephalin-degrading enzymes. Spinorphin inhibits aminopeptidase, dipeptidyl aminopeptidase III, angiotensin-converting enzyme and enkephalinase. Spinorphin possesses an antinociceptive effect[1]. |
| Name | Spinorphin |
|---|
| Description | Spinorphin is an inhibitor of enkephalin-degrading enzymes. Spinorphin inhibits aminopeptidase, dipeptidyl aminopeptidase III, angiotensin-converting enzyme and enkephalinase. Spinorphin possesses an antinociceptive effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 1256.3ºC at 760 mmHg |
| Molecular Formula | C45H64N8O10 |
| Molecular Weight | 877.03700 |
| Flash Point | 713.6ºC |
| Exact Mass | 876.47500 |
| PSA | 285.38000 |
| LogP | 3.81720 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | BXIFNVGZIMFBQB-DYDSHOKNSA-N |
| SMILES | CC(C)CC(N)C(=O)NC(C(=O)NC(C(=O)NC(Cc1ccc(O)cc1)C(=O)N1CCCC1C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)O)C(C)O)C(C)C)C(C)C |
| Hazard Codes | Xi |
|---|