H-PHE-LYS-LYS-SER-PHE-LYS-LEU-NH2
Modify Date: 2025-08-21 20:31:12
H-PHE-LYS-LYS-SER-PHE-LYS-LEU-NH2 structure
|
Common Name | H-PHE-LYS-LYS-SER-PHE-LYS-LEU-NH2 | ||
|---|---|---|---|---|
| CAS Number | 137168-33-3 | Molecular Weight | 896.130 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 1275.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C45H73N11O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 725.3±34.3 °C | |
Use of H-PHE-LYS-LYS-SER-PHE-LYS-LEU-NH2FKKSFKL-NH2 is a protein kinase C-selective peptide. FKKSFKL-NH2 can be used for the research of various biochemical[1]. |
| Name | L-Phenylalanyl-L-lysyl-L-lysyl-L-seryl-L-phenylalanyl-L-lysyl-L-leucinamide |
|---|---|
| Synonym | More Synonyms |
| Description | FKKSFKL-NH2 is a protein kinase C-selective peptide. FKKSFKL-NH2 can be used for the research of various biochemical[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 1275.7±65.0 °C at 760 mmHg |
| Molecular Formula | C45H73N11O8 |
| Molecular Weight | 896.130 |
| Flash Point | 725.3±34.3 °C |
| Exact Mass | 895.564331 |
| LogP | 0.21 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | VDDADTOEBCGDNO-CXWHUAPYSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(Cc1ccccc1)NC(=O)C(CO)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(N)Cc1ccccc1)C(N)=O |
| L-Phenylalanyl-L-lysyl-L-lysyl-L-seryl-L-phenylalanyl-L-lysyl-L-leucinamide |
| L-Leucinamide, L-phenylalanyl-L-lysyl-L-lysyl-L-seryl-L-phenylalanyl-L-lysyl- |