RO-7
Modify Date: 2025-08-25 03:42:04
RO-7 structure
|
Common Name | RO-7 | ||
|---|---|---|---|---|
| CAS Number | 1370241-45-4 | Molecular Weight | 487.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20F3N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RO-7RO-7 is a next-generation polymerase (PA) endonuclease inhibitor of influenza A and B viruses. |
| Name | RO-7 |
|---|
| Description | RO-7 is a next-generation polymerase (PA) endonuclease inhibitor of influenza A and B viruses. |
|---|---|
| Related Catalog | |
| In Vitro | RO-7 is a compound that potently inhibits influenza virus replication and belongs to a new class of drugs in late-stage clinical trials for treatment of influenza virus infection. RO-7 displays broad-spectrum anti-influenza activity in vitro and protects mice from lethal challenge with both influenza A and B viruses[1]. |
| In Vivo | RO-7 protects mice from lethal challenge with both influenza A and B viruses[1]. |
| References |
| Molecular Formula | C24H20F3N3O3S |
|---|---|
| Molecular Weight | 487.49 |
| InChIKey | XEOTUHPFOHTFEX-VLIAUNLRSA-N |
| SMILES | CC(N1CN(C2c3ccccc3CSc3ccccc32)n2ccc(=O)c(O)c2C1=O)C(F)(F)F |