N-(p-Nitrophenethyl)spiperone structure
|
Common Name | N-(p-Nitrophenethyl)spiperone | ||
|---|---|---|---|---|
| CAS Number | 136247-18-2 | Molecular Weight | 544.61700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H33FN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-[4-(4-fluorophenyl)-4-oxobutyl]-3-[2-(4-nitrophenyl)ethyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H33FN4O4 |
|---|---|
| Molecular Weight | 544.61700 |
| Exact Mass | 544.24900 |
| PSA | 89.68000 |
| LogP | 5.54440 |
| Index of Refraction | 1.651 |
| InChIKey | VAROERVHUKRDNF-UHFFFAOYSA-N |
| SMILES | O=C(CCCN1CCC2(CC1)C(=O)N(CCc1ccc([N+](=O)[O-])cc1)CN2c1ccccc1)c1ccc(F)cc1 |
|
~%
N-(p-Nitrophene... CAS#:136247-18-2 |
| Literature: Bakthavachalam, Venkatesalu; Baindur, Nandkishore; Madras, Bertha K.; Neumeyer, John L. Journal of Medicinal Chemistry, 1991 , vol. 34, # 11 p. 3235 - 3241 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-(p-Nitrophenethyl)spiperone |