[2-[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]oxy-2-oxoethyl] 2-[(7-chloroquinolin-4-yl)amino]benzoate structure
|
Common Name | [2-[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]oxy-2-oxoethyl] 2-[(7-chloroquinolin-4-yl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 86518-60-7 | Molecular Weight | 589.03800 | |
| Density | 1.4g/cm3 | Boiling Point | 747.9ºC at 760 mmHg | |
| Molecular Formula | C31H29ClN4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 406.1ºC | |
| Name | [2-[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]oxy-2-oxoethyl] 2-[(7-chloroquinolin-4-yl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 747.9ºC at 760 mmHg |
| Molecular Formula | C31H29ClN4O6 |
| Molecular Weight | 589.03800 |
| Flash Point | 406.1ºC |
| Exact Mass | 588.17800 |
| PSA | 126.58000 |
| LogP | 6.48120 |
| Index of Refraction | 1.674 |
| InChIKey | JIUVZPFRBKHRKD-UHFFFAOYSA-N |
| SMILES | O=C(COC(=O)c1ccccc1Nc1ccnc2cc(Cl)ccc12)OC1CCN(CCc2ccc([N+](=O)[O-])cc2)CC1 |
|
~67%
[2-[1-[2-(4-nit... CAS#:86518-60-7 |
| Literature: Recordati, S. A., Chemical and Pharmaceutical Co. Patent: US4482561 A1, 1984 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,2-((7-chloro-4-quinolinyl)amino)-,2-((1-(2-(4-nitrophenyl)ethyl)-4-piperidinyl)oxy)-2-oxoethyl ester |
| N-(p-Nitrophenethyl-4-piperidyl) N-(7-chloro-4-quinolyl)anthraniloyloxyacetate |