1-(methoxymethyl)-5-methyl-6-phenylsulfanylpyrimidine-2,4-dione structure
|
Common Name | 1-(methoxymethyl)-5-methyl-6-phenylsulfanylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 136160-17-3 | Molecular Weight | 278.32700 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(methoxymethyl)-5-methyl-6-phenylsulfanylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.32700 |
| Exact Mass | 278.07300 |
| PSA | 89.65000 |
| LogP | 2.01240 |
| Index of Refraction | 1.631 |
| InChIKey | FQLWRAIVAUAJFY-UHFFFAOYSA-N |
| SMILES | COCn1c(Sc2ccccc2)c(C)c(=O)[nH]c1=O |
|
~70%
1-(methoxymethy... CAS#:136160-17-3 |
| Literature: Mitsubishi Kasei Corporation Patent: US5461060 A1, 1995 ; |
|
~%
1-(methoxymethy... CAS#:136160-17-3 |
| Literature: Tanaka, Hiromichi; Takashima, Hideaki; Ubasawa, Masaru; Sekiya, Kouichi; Nitta, Issei; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 25 p. 4713 - 4719 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-Methoxymethyl-6-(phenylthio)thymine |
| 1-MeOMe-6PhS T |