Bisphenol M
Modify Date: 2025-08-25 12:22:19
Bisphenol M structure
|
Common Name | Bisphenol M | ||
|---|---|---|---|---|
| CAS Number | 13595-25-0 | Molecular Weight | 346.462 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 495.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C24H26O2 | Melting Point | 135-139ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 220.1±20.5 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
| Name | 1,3-Bis[2-(4-hydroxyphenyl)-2-propyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.9±35.0 °C at 760 mmHg |
| Melting Point | 135-139ºC(lit.) |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.462 |
| Flash Point | 220.1±20.5 °C |
| Exact Mass | 346.193268 |
| PSA | 40.46000 |
| LogP | 6.12 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | PVFQHGDIOXNKIC-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1cccc(C(C)(C)c2ccc(O)cc2)c1 |
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H361f-H411 |
| Precautionary Statements | P201-P273-P280-P308 + P313-P333 + P313-P391 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Hazard Class | 9.0 |
| HS Code | 2907299090 |
|
~%
Bisphenol M CAS#:13595-25-0 |
| Literature: US6326522 B1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![1,3-bis[2-[4-(4-nitrophenoxy)phenyl]propan-2-yl]benzene structure](https://image.chemsrc.com/caspic/276/135672-39-8.png)
CAS#:135672-39-8| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
|
Development of complementary HPLC-DAD/APCI MS methods for chemical characterization of pharmaceutical packaging materials.
J. Pharm. Biomed. Anal. 124 , 228-35, (2016) The chemical characterization of plastics for pharmaceutical packaging has been subject to ever increasing regulatory scrutiny, the reasons for which being: a) plastic additives and degradation produc... |
| 4,4'-(1,3-Phenylenedipropane-2,2-diyl)diphenol |
| 4,4'-(1,3-Phenylenedi-2,2-propanediyl)diphenol |
| 4,4'-[1,3-Phenylenebis(1-methylethylidene)]bisphenol |
| Phenol, 4,4'-[1,3-phenylenebis(1-methylethylidene)]bis- |
| 4-[2-[3-[2-(4-hydroxyphenyl)propan-2-yl]phenyl]propan-2-yl]phenol |
| QR DX1&1&R CX1&1&R DQ |
| 4,4′-(1,3-Phenylenediisopropylidene)bisphenol |
| MFCD00134688 |
| Bisphenol M |
| 4,4'-(1,3-Phenylenediisopropylidene)bisphenol |