Bisphenol A diallyl ether structure
|
Common Name | Bisphenol A diallyl ether | ||
|---|---|---|---|---|
| CAS Number | 3739-67-1 | Molecular Weight | 308.41400 | |
| Density | 1.004 g/cm3 | Boiling Point | 430.5ºC at 760 mmHg | |
| Molecular Formula | C21H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-prop-2-enoxy-4-[2-(4-prop-2-enoxyphenyl)propan-2-yl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.004 g/cm3 |
|---|---|
| Boiling Point | 430.5ºC at 760 mmHg |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.41400 |
| Exact Mass | 308.17800 |
| PSA | 18.46000 |
| LogP | 5.14210 |
| Index of Refraction | 1.536 |
| InChIKey | SCZZNWQQCGSWSZ-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc(C(C)(C)c2ccc(OCC=C)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2942000000 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| bis(alyl ether) of 4,4'-isopropylidene diphenol |
| Benzene,1,1'-(1-methylethylidene)bis(4-(2-propenyloxy) |
| Bisphenol A diallyl ether |
| 4,4'-Isopropylidenebis[(allyloxy)benzene] |
| EINECS 223-123-3 |
| bis(allyl ether) of 4,4'-isopropylidenediphenol |
| 2,2-bis-(4-allyloxy-phenyl)-propane |
| 2,2-Bis-(4-allyloxy-phenyl)-propan |