MMP-2/MMP-9 Fluorogenic Substrate I
Modify Date: 2025-08-27 11:55:07
MMP-2/MMP-9 Fluorogenic Substrate I structure
|
Common Name | MMP-2/MMP-9 Fluorogenic Substrate I | ||
|---|---|---|---|---|
| CAS Number | 135662-07-6 | Molecular Weight | 1012.10000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H61N13O13S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MMP-2/MMP-9 Fluorogenic Substrate IDNP-PLGMWSR is a? fluorogenic substrate for MMP-2 and MMP-9[1]. |
| Name | DNP-Pro-Leu-Gly-Met-Trp-Ser-Arg-OH |
|---|
| Description | DNP-PLGMWSR is a? fluorogenic substrate for MMP-2 and MMP-9[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C44H61N13O13S |
|---|---|
| Molecular Weight | 1012.10000 |
| Exact Mass | 1011.42000 |
| PSA | 430.00000 |
| LogP | 4.52310 |
| InChIKey | AZDJGXPMCRXEQN-SUUSVYONSA-N |
| SMILES | CSCCC(NC(=O)CNC(=O)C(CC(C)C)NC(=O)C1CCCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:65985-66-2