CP 80633 structure
|
Common Name | CP 80633 | ||
|---|---|---|---|---|
| CAS Number | 135637-46-6 | Molecular Weight | 316.395 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 543.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.2±30.1 °C | |
Use of CP 80633Atizoram (CP-80,633), a cyclic nucleotide phosphodiesterase (PDE4) inhibitor, elevates plasma cyclic AMP levels and decreases tumor necrosis factor-α (TNFα) production in mice[1]. |
| Name | 5-[3-[[(3S)-3-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]-1,3-diazinan-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Atizoram (CP-80,633), a cyclic nucleotide phosphodiesterase (PDE4) inhibitor, elevates plasma cyclic AMP levels and decreases tumor necrosis factor-α (TNFα) production in mice[1]. |
|---|---|
| Related Catalog | |
| Target |
PDE4 |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.0±50.0 °C at 760 mmHg |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.395 |
| Flash Point | 282.2±30.1 °C |
| Exact Mass | 316.178680 |
| PSA | 59.59000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | LITNEAPWQHVPOK-TZDAIYRESA-N |
| SMILES | COc1ccc(C2CNC(=O)NC2)cc1OC1CC2CCC1C2 |
|
~74%
CP 80633 CAS#:135637-46-6 |
| Literature: US6399776 B2, ; Page column 18,19 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Methyl-GABA |
| 5-{3-[(1S,2S,4R)-Bicyclo[2.2.1]hept-2-yloxy]-4-methoxyphenyl}tetrahydropyrimidin-2(1H)-one |
| Atizoram |
| UNII-O84FJB49WI |
| 2(1H)-Pyrimidinone, 5-[3-[(1S,2S,4R)-bicyclo[2.2.1]hept-2-yloxy]-4-methoxyphenyl]tetrahydro- |
| 5-(3-((1S,2S,4R)-Bicyclo[2.2.1]hept-2-yloxy)-4-(methyloxy)phenyl)tetrahydro-2(1H)-pyrimidinone |
| Tetrahydro-5-(4-methoxy-3-((1S,2S,4R)-2-norbomyloxy)phenyl)-2(1H)-pyrimidinone |
| 5-{3-[(1S,2S,4R)-Bicyclo[2.2.1]hept-2-yloxy]-4-methoxyphenyl}tetrahydro-2(1H)-pyrimidinone |