2-nitro-1-(oxiran-2-ylmethyl)imidazole structure
|
Common Name | 2-nitro-1-(oxiran-2-ylmethyl)imidazole | ||
|---|---|---|---|---|
| CAS Number | 13551-90-1 | Molecular Weight | 169.13800 | |
| Density | 1.7g/cm3 | Boiling Point | 393.4ºC at 760 mmHg | |
| Molecular Formula | C6H7N3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 191.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(2,3-Epoxypropyl)-2-nitroimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 393.4ºC at 760 mmHg |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.13800 |
| Flash Point | 191.7ºC |
| Exact Mass | 169.04900 |
| PSA | 76.17000 |
| LogP | 0.71330 |
| Vapour Pressure | 2.14E-06mmHg at 25°C |
| Index of Refraction | 1.717 |
| InChIKey | SYFMSLVOHQZYEB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1nccn1CC1CO1 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-nitro-1-(oxiran-2-ylmethyl)imidazole |