clathrodin
Modify Date: 2025-08-31 14:24:50
clathrodin structure
|
Common Name | clathrodin | ||
|---|---|---|---|---|
| CAS Number | 135383-64-1 | Molecular Weight | 231.25400 | |
| Density | 1.382g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H13N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of clathrodinClathrodin is a marine alkaloid that can be isolated from sponges of the genus, Agelas. Clathrodin is a modulator of voltage-gated sodium (NaV) channels. Clathrodin is a sodium channel neurotoxin influencing sodium channel ionic conductance[1][2]. |
| Name | N-[(E)-3-(2-amino-1H-imidazol-5-yl)prop-2-enyl]-1H-pyrrole-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Clathrodin is a marine alkaloid that can be isolated from sponges of the genus, Agelas. Clathrodin is a modulator of voltage-gated sodium (NaV) channels. Clathrodin is a sodium channel neurotoxin influencing sodium channel ionic conductance[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.382g/cm3 |
|---|---|
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.25400 |
| Exact Mass | 231.11200 |
| PSA | 100.32000 |
| LogP | 1.08420 |
| Index of Refraction | 1.726 |
| InChIKey | PJKFCZYTTBYEHL-HNQUOIGGSA-N |
| SMILES | Nc1ncc(C=CCNC(=O)c2ccc[nH]2)[nH]1 |
| Clathrodine |
| Clathrodin |
| N-(3-(2-Imino-2,3-dihydro-1H-imidazol-4-yl)-2-propenyl)-1H-pyrrole-2-carboxamide |
| 1H-Pyrrole-2-carboxamide,N-(3-(2-amino-1H-imidazol-4-yl)-2-propenyl)-,(E) |