U 90042 structure
|
Common Name | U 90042 | ||
|---|---|---|---|---|
| CAS Number | 134516-99-7 | Molecular Weight | 352.77800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13ClN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of U 90042U 90042 is a GABAA receptor ligand with sedative and hypnotic properties. |
| Name | (S)-(-)-Atenolo |
|---|
| Molecular Formula | C17H13ClN6O |
|---|---|
| Molecular Weight | 352.77800 |
| Exact Mass | 352.08400 |
| PSA | 73.51000 |
| LogP | 2.21970 |
| InChIKey | CLPSAAPUJUVQPP-UHFFFAOYSA-N |
| SMILES | Clc1ccc2c(c1)C1=NCCN1c1c(-c3noc(C4CC4)n3)ncn1-2 |