(E/Z)-AG490
Modify Date: 2025-08-26 10:47:38
(E/Z)-AG490 structure
|
Common Name | (E/Z)-AG490 | ||
|---|---|---|---|---|
| CAS Number | 134036-52-5 | Molecular Weight | 294.30500 | |
| Density | 1.337g/cm3 | Boiling Point | 615.2ºC at 760mmHg | |
| Molecular Formula | C17H14N2O3 | Melting Point | 215ºC | |
| MSDS | N/A | Flash Point | 325.9ºC | |
Use of (E/Z)-AG490(E/Z)-AG490 ((E/Z)-Tyrphostin AG490) is a racemic compound of (E)-AG490 and (Z)-AG490 isomers. (E)-AG490 (HY-12000) is a tyrosine kinase inhibitor that inhibits EGFR, Stat-3 and JAK2/3. |
| Name | ag 490 |
|---|---|
| Synonym | More Synonyms |
| Description | (E/Z)-AG490 ((E/Z)-Tyrphostin AG490) is a racemic compound of (E)-AG490 and (Z)-AG490 isomers. (E)-AG490 (HY-12000) is a tyrosine kinase inhibitor that inhibits EGFR, Stat-3 and JAK2/3. |
|---|---|
| Related Catalog |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 615.2ºC at 760mmHg |
| Melting Point | 215ºC |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.30500 |
| Flash Point | 325.9ºC |
| Exact Mass | 294.10000 |
| PSA | 93.35000 |
| LogP | 2.71208 |
| InChIKey | TUCIOBMMDDOEMM-UHFFFAOYSA-N |
| SMILES | N#CC(=Cc1ccc(O)c(O)c1)C(=O)NCc1ccccc1 |
| Storage condition | −20°C |
| Water Solubility | ethanol: 5 mg/mL |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 1 |
| MFCD00209833 |