2-(anilinomethyl)isoindole-1,3-dione structure
|
Common Name | 2-(anilinomethyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 13314-96-0 | Molecular Weight | 252.26800 | |
| Density | 1.345g/cm3 | Boiling Point | 450ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226ºC | |
| Name | 2-(anilinomethyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.345g/cm3 |
|---|---|
| Boiling Point | 450ºC at 760 mmHg |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.26800 |
| Flash Point | 226ºC |
| Exact Mass | 252.09000 |
| PSA | 49.41000 |
| LogP | 2.36310 |
| Vapour Pressure | 2.72E-08mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | YQBGAGYLFPRNEM-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CNc1ccccc1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-Anilinomethyl-phthalimid |
| N-anilinomethyl-phthalimide |
| 2-Phenylaminomethyl-isoindole-1,3-dione |