HOE-S 785026 structure
|
Common Name | HOE-S 785026 | ||
|---|---|---|---|---|
| CAS Number | 132869-83-1 | Molecular Weight | 424.49800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H24N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HOE-S 785026HOE-S 785026 is a blue fluorescent dyes, which can be used as a cell dye for DNA. |
| Name | 3-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Description | HOE-S 785026 is a blue fluorescent dyes, which can be used as a cell dye for DNA. |
|---|---|
| Related Catalog | |
| In Vitro | Hoechst stains are part of a family of blue fluorescent dyes used to stain DNA. HOES 785026 is a Hoechst stains are part of a family of blue fluorescent dyes used to stain DNA. |
| Molecular Formula | C25H24N6O |
|---|---|
| Molecular Weight | 424.49800 |
| Exact Mass | 424.20100 |
| PSA | 84.07000 |
| LogP | 4.23350 |
| InChIKey | WOFDIDGQAOQHGY-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2ccc3nc(-c4ccc5nc(-c6cccc(O)c6)[nH]c5c4)[nH]c3c2)CC1 |
| Storage condition | 2-8℃ |
| meta-Hoechst |
| CS-1305 |
| HOE-S 785026 |