N-(6-AMINOPYRIDIN-2-YL)PIVALAMIDE structure
|
Common Name | N-(6-AMINOPYRIDIN-2-YL)PIVALAMIDE | ||
|---|---|---|---|---|
| CAS Number | 132784-74-8 | Molecular Weight | 193.24600 | |
| Density | 1.153g/cm3 | Boiling Point | 408.861ºC at 760 mmHg | |
| Molecular Formula | C10H15N3O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 201.072ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(6-Amino-2-pyridinyl)-2,2-dimethylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 408.861ºC at 760 mmHg |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.24600 |
| Flash Point | 201.072ºC |
| Exact Mass | 193.12200 |
| PSA | 68.01000 |
| LogP | 2.30260 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | ZEQSQAMGUMPKIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1cccc(N)n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~98%
N-(6-AMINOPYRID... CAS#:132784-74-8 |
| Literature: McGrath, Jacqueline M.; Pluth, Michael D. Journal of Organic Chemistry, 2014 , vol. 79, # 2 p. 711 - 719 |
|
~%
N-(6-AMINOPYRID... CAS#:132784-74-8 |
| Literature: WO2006/82107 A1, ; Page/Page column 40 ; WO 2006/082107 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(6-Amino-pyridin-2-yl)-2,2-dimethyl-propionamide |
| N-(6-aminopyridin-2-yl)-2,2-dimethylpropanamide |
| N-(6-Aminopyridin-2-yl)pivalamide |