NifluMic acid-13C6 structure
|
Common Name | NifluMic acid-13C6 | ||
|---|---|---|---|---|
| CAS Number | 1325559-33-8 | Molecular Weight | 288.174 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C713C6H9F3N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of NifluMic acid-13C6Niflumic acid-13C6 is the 13C6 labeled Niflumic acid. Niflumic acid, a Ca2+-activated Cl- channel blocker, is an analgesic and anti-inflammatory agent used in the treatment of rheumatoid arthritis. |
| Name | NifluMic acid-13C6 |
|---|---|
| Synonym | More Synonyms |
| Description | Niflumic acid-13C6 is the 13C6 labeled Niflumic acid. Niflumic acid, a Ca2+-activated Cl- channel blocker, is an analgesic and anti-inflammatory agent used in the treatment of rheumatoid arthritis. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C713C6H9F3N2O2 |
| Molecular Weight | 288.174 |
| Exact Mass | 288.081726 |
| Index of Refraction | 1.589 |
| InChIKey | JZFPYUNJRRFVQU-IKCRXMKJSA-N |
| SMILES | O=C(O)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| 3-Pyridinecarboxylic acid, 2-[[3-(trifluoromethyl)phenyl-1,2,3,4,5,6-13C6]amino]- |
| MFCD19704813 |
| Niflumic acid-(phenyl-13C6) |
| 2-(3-Trifluoromethylphenyl-13C6-amino)nicotinic acid |
| 2-{[3-(Trifluoromethyl)(13C6)phenyl]amino}nicotinic acid |