4-Amino-1-pentofuranosyl-2(1H)-pyrimidinethione
Modify Date: 2024-01-06 11:09:46
4-Amino-1-pentofuranosyl-2(1H)-pyrimidinethione structure
|
Common Name | 4-Amino-1-pentofuranosyl-2(1H)-pyrimidinethione | ||
|---|---|---|---|---|
| CAS Number | 13239-97-9 | Molecular Weight | 259.28 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 540.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C9H13N3O4S | Melting Point | 208-209 °C (lit.) | |
| MSDS | N/A | Flash Point | 280.7±32.9 °C | |
Use of 4-Amino-1-pentofuranosyl-2(1H)-pyrimidinethione2-Thiocytidine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 2-thiocytidine |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Thiocytidine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 540.5±60.0 °C at 760 mmHg |
| Melting Point | 208-209 °C (lit.) |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.28 |
| Flash Point | 280.7±32.9 °C |
| Exact Mass | 259.062683 |
| PSA | 145.85000 |
| LogP | -1.33 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.788 |
| InChIKey | RHFUOMFWUGWKKO-XVFCMESISA-N |
| SMILES | Nc1ccn(C2OC(CO)C(O)C2O)c(=S)n1 |
| 4-Amino-1-pentofuranosyl-2(1H)-pyrimidinethione |
| 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2-thione |
| 2-Thiocytidin |
| EINECS 236-214-8 |
| 2-Thiocytidine |
| 2(1H)-Pyrimidinethione, 4-amino-1-pentofuranosyl- |
| MFCD00167106 |
| Cytidine,2-thio |