6'-Feruloylnodakenin structure
|
Common Name | 6'-Feruloylnodakenin | ||
|---|---|---|---|---|
| CAS Number | 131623-14-8 | Molecular Weight | 584.57 | |
| Density | 1.48g/cm3 | Boiling Point | 820.4ºC at 760mmHg | |
| Molecular Formula | C30H32O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.3ºC | |
Use of 6'-Feruloylnodakenin6'-O-trans-Feruloylnodakenin is a marker compound used for HPLC fingerprint of N. forbesii[1]. |
| Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[(2R)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yloxy]oxan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | 6'-O-trans-Feruloylnodakenin is a marker compound used for HPLC fingerprint of N. forbesii[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 820.4ºC at 760mmHg |
| Molecular Formula | C30H32O12 |
| Molecular Weight | 584.57 |
| Flash Point | 268.3ºC |
| Exact Mass | 584.18900 |
| PSA | 174.35000 |
| LogP | 1.67010 |
| Vapour Pressure | 1.76E-28mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | AIKVOZSRVVMWGS-VMPITWQZSA-N |
| SMILES | COc1cc(C=CC(=O)OCC2OC(OC(C)(C)C3Cc4cc5ccc(=O)oc5cc4O3)C(O)C(O)C2O)ccc1O |
| Precursor 0 | |
|---|---|
| DownStream 4 | |
| 6'-Feruloylnodakenin |
| 6'-O-trans-feruloylnodakenin |