H-Trp-Leu-OH
Modify Date: 2025-08-25 18:23:17
H-Trp-Leu-OH structure
|
Common Name | H-Trp-Leu-OH | ||
|---|---|---|---|---|
| CAS Number | 13123-35-8 | Molecular Weight | 317.38300 | |
| Density | 1.241g/cm3 | Boiling Point | 624.2ºC at 760mmHg | |
| Molecular Formula | C17H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.3ºC | |
Use of H-Trp-Leu-OHTryptophylleucine (NSC 286600) is a biologically active peptide. |
| Name | (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Tryptophylleucine (NSC 286600) is a biologically active peptide. |
|---|---|
| Related Catalog |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 624.2ºC at 760mmHg |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.38300 |
| Flash Point | 331.3ºC |
| Exact Mass | 317.17400 |
| PSA | 108.21000 |
| LogP | 2.74440 |
| Vapour Pressure | 1.92E-16mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | LYMVXFSTACVOLP-ZFWWWQNUSA-N |
| SMILES | CC(C)CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| HS Code | 2933990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![1,7-dioxo-2,5,6-trimethyl-1H,7H-pyrazolo[1,2-a]pyrazol-3-yl-methylthiomethylcarbonyl-glycyl-L-tryptophyl-L-leucine Structure](https://image.chemsrc.com/caspic/381/120151-93-1.png)
CAS#:120151-93-1
CAS#:78440-76-3| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-Tryptophyl-L-leucine |
| Tryptophyl-Leucine |
| L-Tryptophan-L-leucine |
| L-Leucine,L-tryptophyl |
| L-Trp-L-Leu |