SCO-L-Lysine
Modify Date: 2025-08-26 18:35:37
SCO-L-Lysine structure
|
Common Name | SCO-L-Lysine | ||
|---|---|---|---|---|
| CAS Number | 1309581-49-4 | Molecular Weight | 296.36200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SCO-L-LysineSCO-L-Lysine contains a SCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups. SCO-L-Lysine can be incorporated into the protein of interest by the tRNAPyl/PylRSAF synthetase[1]. |
| Name | N-ε-((cyclooct-2-yn-1-yloxy)carbonyl)-L-lysine |
|---|---|
| Synonym | More Synonyms |
| Description | SCO-L-Lysine contains a SCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups. SCO-L-Lysine can be incorporated into the protein of interest by the tRNAPyl/PylRSAF synthetase[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H24N2O4 |
|---|---|
| Molecular Weight | 296.36200 |
| Exact Mass | 296.17400 |
| PSA | 101.65000 |
| LogP | 2.72210 |
| InChIKey | SCZIJGBDOGSCKY-ABLWVSNPSA-N |
| SMILES | NC(CCCCNC(=O)OC1C#CCCCCC1)C(=O)O |
| l-lysine, n6-[(2-cyclooctyn-1-yloxy)carbonyl]- |