E1R structure
|
Common Name | E1R | ||
|---|---|---|---|---|
| CAS Number | 1301211-78-8 | Molecular Weight | 232.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of E1RE1R is a positive allosteric modulator of sigma-1 receptors with cognition-enhancing activity[1]. |
| Name | E1R |
|---|
| Description | E1R is a positive allosteric modulator of sigma-1 receptors with cognition-enhancing activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H16N2O2 |
|---|---|
| Molecular Weight | 232.28 |
| InChIKey | ZTGRWYMPQCQTHD-ONGXEEELSA-N |
| SMILES | CC1C(c2ccccc2)CC(=O)N1CC(N)=O |