Gancaonin G structure
|
Common Name | Gancaonin G | ||
|---|---|---|---|---|
| CAS Number | 126716-34-5 | Molecular Weight | 352.380 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 574.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.1±23.6 °C | |
Use of Gancaonin GGancaonin G is a 6-prenylated isoflavanone that can be isolated from Glycyrrhiza uralensis. Gancaonin G has antibacterial activity against Streptococcus mutants and MRSA strains[1]. |
| Name | 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-6-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Gancaonin G is a 6-prenylated isoflavanone that can be isolated from Glycyrrhiza uralensis. Gancaonin G has antibacterial activity against Streptococcus mutants and MRSA strains[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. He J, et al. Antibacterial compounds from Glycyrrhiza uralensis. J Nat Prod. 2006 Jan;69(1):121-4. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 574.8±50.0 °C at 760 mmHg |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.380 |
| Flash Point | 205.1±23.6 °C |
| Exact Mass | 352.131073 |
| PSA | 79.90000 |
| LogP | 5.63 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | WLPHLDLTTPUDSI-UHFFFAOYSA-N |
| SMILES | COc1cc2occ(-c3ccc(O)cc3)c(=O)c2c(O)c1CC=C(C)C |
| Hazard Codes | Xi |
|---|
| 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-6-(3-methyl-2-buten-1-yl)-4H-chromen-4-one |
| 5-Hydroxy-3-(4-hydroxy-phenyl)-7-methoxy-6-(3-methyl-but-2-enyl)-1-benzopyran-4-one |
| 4H-1-Benzopyran-4-one, 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-6-(3-methyl-2-buten-1-yl)- |
| Gancaonin G |