GSK-729
Modify Date: 2025-11-25 18:21:58
GSK-729 structure
|
Common Name | GSK-729 | ||
|---|---|---|---|---|
| CAS Number | 1260243-45-5 | Molecular Weight | 339.318 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GSK-729A potent, small molecule inhibitor of Mycobacterium tuberculosis enoyl-coenzyme A (CoA) hydratase EchA6 with IC50 of 1.8 uM, but not the MmpL3. |
| Name | GSK-729 |
|---|
| Description | A potent, small molecule inhibitor of Mycobacterium tuberculosis enoyl-coenzyme A (CoA) hydratase EchA6 with IC50 of 1.8 uM, but not the MmpL3. |
|---|
| Molecular Formula | C16H16F3N3O2 |
|---|---|
| Molecular Weight | 339.318 |
| InChIKey | PZUHMVXZBLEHFM-QWHCGFSZSA-N |
| SMILES | CCc1ccc(C2CC(C(F)(F)F)n3ncc(C(=O)O)c3N2)cc1 |