1,3-Bis(glycidoxypropyl)tetramethyldisiloxane structure
|
Common Name | 1,3-Bis(glycidoxypropyl)tetramethyldisiloxane | ||
|---|---|---|---|---|
| CAS Number | 126-80-7 | Molecular Weight | 362.609 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 374.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C16H34O5Si2 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 149.1±24.1 °C | |
| Name | 1,1,3,3-Tetramethyl-1,3-bis[3-(2-oxiranylmethoxy)propyl]disiloxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.2±27.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C16H34O5Si2 |
| Molecular Weight | 362.609 |
| Flash Point | 149.1±24.1 °C |
| Exact Mass | 362.194489 |
| PSA | 52.75000 |
| LogP | 4.48 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.460 |
| InChIKey | MFIBZDZRPYQXOM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCCOCC1CO1)O[Si](C)(C)CCCOCC1CO1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2934999090 |
|
~%
1,3-Bis(glycido... CAS#:126-80-7 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 2632,2633 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1,3,3-Tetramethyl-1,3-bis[3-(2-oxiranylmethoxy)propyl]disiloxane |
| Disiloxane, 1,1,3,3-tetramethyl-1,3-bis[3-(oxiranylmethoxy)propyl]- |
| 1,3-Bis(3-(2,3-epoxypropoxy)-propyl)tetramethyldisiloxane |
| [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
| EINECS 204-803-9 |
| MFCD00039672 |
| 1,3-Bis(3-(2,3-epoxypropoxy)propyl)tetramethyldisiloxane |
| 1,3-Bis(glycidoxypropyl)tetramethyldisiloxane |
| 1,1,3,3-Tetramethyl-1,3-bis[3-(oxiran-2-ylmethoxy)propyl]disiloxane |
| 1,3-Bis(3-(glycidyloxy)propyl)-1,1,3,3-tetramethyldisiloxane |
| Disiloxane, 1,1,3,3-tetramethyl-1,3-bis(3-(oxiranylmethoxy)propyl)- |
| Disiloxane, 1,3-bis[3-(2,3-epoxypropoxy)propyl]-1,1,3,3-tetramethyl- |