tert-Butyl (1-(4-aminophenyl)cyclobutyl)carbamate structure
|
Common Name | tert-Butyl (1-(4-aminophenyl)cyclobutyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 1259224-00-4 | Molecular Weight | 262.347 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 416.7±34.0 °C at 760 mmHg | |
| Molecular Formula | C15H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.8±25.7 °C | |
| Name | tert-Butyl (1-(4-aminophenyl)cyclobutyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.7±34.0 °C at 760 mmHg |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.347 |
| Flash Point | 205.8±25.7 °C |
| Exact Mass | 262.168121 |
| PSA | 67.84000 |
| LogP | 2.38 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | SOYSJYBVYFILEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(N)cc2)CCC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid, N-[1-(4-aminophenyl)cyclobutyl]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl [1-(4-aminophenyl)cyclobutyl]carbamate |
| tert-butyl N-[1-(4-aminophenyl)cyclobutyl]carbamate |