tert-Butyl 1-(4-cyanophenyl)cyclobutylcarbamate structure
|
Common Name | tert-Butyl 1-(4-cyanophenyl)cyclobutylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 1032349-97-5 | Molecular Weight | 272.342 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 421.5±34.0 °C at 760 mmHg | |
| Molecular Formula | C16H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.7±25.7 °C | |
| Name | tert-Butyl 1-(4-cyanophenyl)cyclobutylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.5±34.0 °C at 760 mmHg |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.342 |
| Flash Point | 208.7±25.7 °C |
| Exact Mass | 272.152466 |
| PSA | 65.61000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | MVZPOTHSWMRTJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(C#N)cc2)CCC1 |
| HS Code | 2926909090 |
|---|
|
~59%
tert-Butyl 1-(4... CAS#:1032349-97-5 |
| Literature: Kettle, Jason G.; Brown, Simon; Crafter, Claire; Davies, Barry R.; Dudley, Phillippa; Fairley, Gary; Faulder, Paul; Fillery, Shaun; Greenwood, Hannah; Hawkins, Janet; James, Michael; Johnson, Keith; Lane, Clare D.; Pass, Martin; Pink, Jennifer H.; Plant, Helen; Cosulich, Sabina C. Journal of Medicinal Chemistry, 2012 , vol. 55, # 3 p. 1261 - 1273 |
|
~%
tert-Butyl 1-(4... CAS#:1032349-97-5 |
| Literature: US2008/161317 A1, ; Page/Page column 59-60 ; |
|
~%
tert-Butyl 1-(4... CAS#:1032349-97-5 |
| Literature: US2008/161317 A1, ; Page/Page column 30-31 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| tert-butyl N-[1-(4-cyanophenyl)cyclobutyl]carbamate |