tert-butyl 3-(2-hydroxypropan-2-yl)azetidine-1-carboxylate structure
|
Common Name | tert-butyl 3-(2-hydroxypropan-2-yl)azetidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1257293-79-0 | Molecular Weight | 215.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 290.9±13.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.7±19.8 °C | |
| Name | 2-Methyl-2-propanyl 3-(2-hydroxy-2-propanyl)-1-azetidinecarboxyla te |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 290.9±13.0 °C at 760 mmHg |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.289 |
| Flash Point | 129.7±19.8 °C |
| Exact Mass | 215.152145 |
| PSA | 49.77000 |
| LogP | 0.71 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | GMOIZAKBLSIACP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C)(C)O)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-HYDROXY-ETHYL)-PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER |
| 2-Methyl-2-propanyl 3-(2-hydroxy-2-propanyl)-1-azetidinecarboxylate |
| tert-butyl 3-(2-hydroxypropan-2-yl)azetidine-1-carboxylate |
| AS-P1 |
| 1-Azetidinecarboxylic acid, 3-(1-hydroxy-1-methylethyl)-, 1,1-dimethylethyl ester |
| 1-Boc-3-(1-hydroxy-1-methylethyl)-azetidine |