4-Methyl-3-oxo-N-phenylpentanamide structure
|
Common Name | 4-Methyl-3-oxo-N-phenylpentanamide | ||
|---|---|---|---|---|
| CAS Number | 124401-38-3 | Molecular Weight | 205.253 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 384.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.8±23.3 °C | |
| Name | 4-Methyl-3-oxopentanoic acid anilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 384.4±25.0 °C at 760 mmHg |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.253 |
| Flash Point | 158.8±23.3 °C |
| Exact Mass | 205.110275 |
| PSA | 46.17000 |
| LogP | 1.73 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | ADHRFDCBLJVNFO-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)CC(=O)Nc1ccccc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2925190090 |
|
~91%
4-Methyl-3-oxo-... CAS#:124401-38-3 |
| Literature: VIJAYASRI ORGANICS LIMITED; SRIVATSAVAYI, Jagapathi Raju; POTHUKUCHI, Sairam; RANI, Srinivasa Sastry; CHIKKA, Mallikarjuna Rao; CHEEKATI, Chiranjeevi; GUTTI, Mallikarjuna Rao; SINGAVARAPU, Trimurthulu; THIMMAIPALLY , Venkat Reddy; TADANKI, Venkateswara Rao Patent: WO2012/143933 A1, 2012 ; Location in patent: Page/Page column 21-22 ; |
|
~%
4-Methyl-3-oxo-... CAS#:124401-38-3 |
| Literature: US5998633 A1, ; |
|
~85%
4-Methyl-3-oxo-... CAS#:124401-38-3 |
| Literature: Angelov, Plamen Synlett, 2010 , # 8 art. no. G06610ST, p. 1273 - 1275 |
|
~%
4-Methyl-3-oxo-... CAS#:124401-38-3 |
| Literature: Chemistry - A European Journal, , vol. 18, # 20 p. 6152 - 6157 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Methyl-3-oxo-N-phenylpentanamide |
| Pentanamide, 4-methyl-3-oxo-N-phenyl- |
| N-Phenyl Isobutyrylacetamide |
| MFCD00137795 |
| N-Phenyl-isobutyloylacetamide |