Benzene,1,1'-sulfonylbis[4-methyl-3-nitro-
Modify Date: 2025-08-20 23:09:14
Benzene,1,1'-sulfonylbis[4-methyl-3-nitro- structure
|
Common Name | Benzene,1,1'-sulfonylbis[4-methyl-3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 1235-89-8 | Molecular Weight | 336.32000 | |
| Density | 1.437g/cm3 | Boiling Point | 520ºC at 760mmHg | |
| Molecular Formula | C14H12N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.3ºC | |
| Name | 1-methyl-4-(4-methyl-3-nitrophenyl)sulfonyl-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.437g/cm3 |
|---|---|
| Boiling Point | 520ºC at 760mmHg |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.32000 |
| Flash Point | 268.3ºC |
| Exact Mass | 336.04200 |
| PSA | 134.16000 |
| LogP | 5.07980 |
| Vapour Pressure | 2.14E-10mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | XMJOAZKUTPHAQT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
|
~%
Benzene,1,1'-su... CAS#:1235-89-8 |
| Literature: Meyer,H. Justus Liebigs Annalen der Chemie, 1923 , vol. 433, p. 342 |
|
~%
Benzene,1,1'-su... CAS#:1235-89-8 |
| Literature: Buehler; Masters Journal of Organic Chemistry, 1939 , vol. 4, p. 262,264 |
CAS#:21646-47-9
CAS#:6338-92-7| 3.3'-Dinitro-4.4'-dimethyl-diphenylsulfon |