Benzenamine,3,3'-sulfonylbis[6-methyl-
Modify Date: 2025-09-21 20:37:41
Benzenamine,3,3'-sulfonylbis[6-methyl- structure
|
Common Name | Benzenamine,3,3'-sulfonylbis[6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 21646-47-9 | Molecular Weight | 276.35400 | |
| Density | 1.285g/cm3 | Boiling Point | 533.8ºC at 760mmHg | |
| Molecular Formula | C14H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.6ºC | |
| Name | 5-(3-amino-4-methylphenyl)sulfonyl-2-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 533.8ºC at 760mmHg |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.35400 |
| Flash Point | 276.6ºC |
| Exact Mass | 276.09300 |
| PSA | 94.56000 |
| LogP | 4.54380 |
| Vapour Pressure | 1.8E-11mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | WXVXQBUEJSQZIJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C)c(N)c2)cc1N |
|
~%
Benzenamine,3,3... CAS#:21646-47-9 |
| Literature: Hart,W.F. et al. Journal of Organic Chemistry, 1962 , vol. 27, p. 338 - 340 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:6338-92-7| 3.3'-Diamino-4.4'-dimethyl-diphenylsulfon |