Methyl dehydroabietate structure
|
Common Name | Methyl dehydroabietate | ||
|---|---|---|---|---|
| CAS Number | 1235-74-1 | Molecular Weight | 314.46200 | |
| Density | 1.017g/cm3 | Boiling Point | 390.2ºC at 760mmHg | |
| Molecular Formula | C21H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.3ºC | |
Use of Methyl dehydroabietateMethyl dehydroabietate is a kind of resin acid that can be isolated from spruce bark. Methyl dehydroabietate has antimicrobial activities[1]. |
| Name | methyl (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Methyl dehydroabietate is a kind of resin acid that can be isolated from spruce bark. Methyl dehydroabietate has antimicrobial activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.017g/cm3 |
|---|---|
| Boiling Point | 390.2ºC at 760mmHg |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.46200 |
| Flash Point | 184.3ºC |
| Exact Mass | 314.22500 |
| PSA | 26.30000 |
| LogP | 4.99330 |
| Vapour Pressure | 2.7E-06mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | PGZCJOPTDHWYES-HMXCVIKNSA-N |
| SMILES | COC(=O)C1(C)CCCC2(C)c3ccc(C(C)C)cc3CCC12 |
| dehydroabietic acid methyl ester |
| Podocarpa-8,13-trien-15-oic acid,13-isopropyl-,methyl ester |
| 1,3,4,4a,9,10,10a-Octahydro-1,4a-dimethyl-7-(1-methylethyl)-1-phenanthrenecarboxylic acid,methyl ester |
| methyl 8,11,12-abietatrien-18-oate |
| Methyl dehydroabietyate |
| abieta-8,11,13-trien-18-oic acid methyl ester |
| METHYL DEHYDROABIETATE |
| methyl abieta-8,11,13-trien-18-oate |
| Methyl 8,13-abietatrien-18-oate |
| methyl 13-isopropylpodocarpe-8,11,13-trien-15-oate |