Siponimod
Modify Date: 2025-08-26 07:09:22
Siponimod structure
|
Common Name | Siponimod | ||
|---|---|---|---|---|
| CAS Number | 1230487-00-9 | Molecular Weight | 516.595 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 602.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C29H35F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.9±34.3 °C | |
Use of SiponimodSiponimod (BAF-312) is a potent and selective sphingosine-1-phosphate (S1P) receptor modulator. It is selective for S1P1 and S1P5 receptors over S1P2, S1P3, and S1P4 (EC50s of 0.39, 0.98, >10,000, >1,000, and 750 nM, respectively.) |
| Name | Siponimod |
|---|---|
| Synonym | More Synonyms |
| Description | Siponimod (BAF-312) is a potent and selective sphingosine-1-phosphate (S1P) receptor modulator. It is selective for S1P1 and S1P5 receptors over S1P2, S1P3, and S1P4 (EC50s of 0.39, 0.98, >10,000, >1,000, and 750 nM, respectively.) |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 602.0±65.0 °C at 760 mmHg |
| Molecular Formula | C29H35F3N2O3 |
| Molecular Weight | 516.595 |
| Flash Point | 317.9±34.3 °C |
| Exact Mass | 516.259949 |
| PSA | 62.13000 |
| LogP | 6.90 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | KIHYPELVXPAIDH-APTWKGOFSA-N |
| SMILES | CCc1cc(C(C)=NOCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1CN1CC(C(=O)O)C1 |
| Storage condition | -20℃ |
| 3-Azetidinecarboxylic acid, 1-[[4-[(1E)-1-[[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]imino]ethyl]-2-ethylphenyl]methyl]- |
| BAF312 |
| 1-{4-[1-((E)-4-cyclohexyl-3-trifluoromethyl-benzyloxyimino)-ethyl]-2-ethyl-benzyl}-azetidine-3-carboxylic acid |
| BAF-312 |
| Siponimod |
| 1-[4-[N-[4-cyclohexyl-3-(trifluoromethyl)benzyloxy]-1(E)-imino ethyl]-2-ethylbenzyl]azetidine-3-carboxylicacid |
| 1-(4-{1-[(E)-4-cyclohexyl-3-trifluoromethylbenzyloxyimino]ethyl}-2-ethylbenzyl)azetidine-3-carboxylic acid |
| 1-{4-[(1E)-N-{[4-Cyclohexyl-3-(trifluoromethyl)benzyl]oxy}ethanimidoyl]-2-ethylbenzyl}-3-azetidinecarboxylic acid |