Bulleyanin structure
|
Common Name | Bulleyanin | ||
|---|---|---|---|---|
| CAS Number | 123043-54-9 | Molecular Weight | 534.595 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 600.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C28H38O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.1±25.0 °C | |
Use of BulleyaninBulleyanin is a compound isolated from isodon species (Labiatae)[1]. |
| Name | (1α,3β,5β,7β,8α,9β,10α,11β,12α,13α)-12-Hydroxy-15-oxokaur-16-ene- 1,3,7,11-tetrayl tetraacetate |
|---|---|
| Synonym | More Synonyms |
| Description | Bulleyanin is a compound isolated from isodon species (Labiatae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 600.9±55.0 °C at 760 mmHg |
| Molecular Formula | C28H38O10 |
| Molecular Weight | 534.595 |
| Flash Point | 189.1±25.0 °C |
| Exact Mass | 534.246521 |
| PSA | 142.50000 |
| LogP | 1.50 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | UHAGZLPOLNCLEQ-JKXJNZBRSA-N |
| SMILES | C=C1C(=O)C23CC1C(O)C(OC(C)=O)C2C1(C)C(OC(C)=O)CC(OC(C)=O)C(C)(C)C1CC3OC(C)=O |
| Hazard Codes | Xi |
|---|
| (1α,3β,5β,7β,8α,9β,10α,11β,12α,13α)-12-Hydroxy-15-oxokaur-16-ene-1,3,7,11-tetrayl tetraacetate |