12-DeMethylneocaesalpin F
Modify Date: 2025-08-23 08:25:31
12-DeMethylneocaesalpin F structure
|
Common Name | 12-DeMethylneocaesalpin F | ||
|---|---|---|---|---|
| CAS Number | 1228964-10-0 | Molecular Weight | 470.55 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 659.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H34O7 | Melting Point | 159-161℃ | |
| MSDS | N/A | Flash Point | 219.8±25.0 °C | |
Use of 12-DeMethylneocaesalpin F12-Demethyl neocaesalpin F is a diterpenoid compound[1]. |
| Name | (4aR,5R,6R,6aS,7R,10aR,11aS,11bR)-4a,6,10a-trihydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,4,4a,5,6,6a,7,9,10a,11,11a,11b-tetradecahydrophenanthro[3,2-b]furan-5-yl benzoate |
|---|---|
| Synonym | More Synonyms |
| Description | 12-Demethyl neocaesalpin F is a diterpenoid compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 659.3±55.0 °C at 760 mmHg |
| Melting Point | 159-161℃ |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.55 |
| Flash Point | 219.8±25.0 °C |
| Exact Mass | 470.230438 |
| PSA | 113.29000 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | VHLRSKHOMKTLFY-UHFFFAOYSA-N |
| SMILES | CC1C2=CC(=O)OC2(O)CC2C1C(O)C(OC(=O)c1ccccc1)C1(O)C(C)(C)CCCC21C |
| Hazard Codes | Xi |
|---|
| Phenanthro[3,2-b]furan-9(1H)-one, 5-(benzoyloxy)-2,3,4,4a,5,6,6a,7,10a,11,11a,11b-dodecahydro-4a,6,10a-trihydroxy-4,4,7,11b-tetramethyl-, (4aR,5R,6R,6aS,7R,10aR,11aS,11bR)- |
| (4aR,5R,6R,6aS,7R,10aR,11aS,11bR)-4a,6,10a-Trihydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,4,4a,5,6,6a,7,9,10a,11,11a,11b-tetradecahydrophenanthro[3,2-b]furan-5-yl benzoate |