(Rac)-Levomepromazine-d3 hydrochloride structure
|
Common Name | (Rac)-Levomepromazine-d3 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1216745-60-6 | Molecular Weight | 367.95 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22D3ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (Rac)-Levomepromazine-d3 hydrochloride(Rac)-Levomepromazine-d3 ((Rac)-Methotrimeprazine-d3) hydrochloride is a labelled racemic Methotrimeprazine, which is a phenothiazine which has antagonist actions at multiple neurotransmitter receptor sites, including dopaminergic, cholinergic, serotonin and histamine receptors[1][2]. |
| Name | (Rac)-Levomepromazine-d3 hydrochloride |
|---|
| Description | (Rac)-Levomepromazine-d3 ((Rac)-Methotrimeprazine-d3) hydrochloride is a labelled racemic Methotrimeprazine, which is a phenothiazine which has antagonist actions at multiple neurotransmitter receptor sites, including dopaminergic, cholinergic, serotonin and histamine receptors[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C19H22D3ClN2OS |
|---|---|
| Molecular Weight | 367.95 |
| InChIKey | ODLGFPIWRAEFAN-NXIGQQGZSA-N |
| SMILES | COc1ccc2c(c1)N(CC(C)CN(C)C)c1ccccc1S2.Cl |