Citric acid-2,4-13C2
Modify Date: 2025-08-25 20:43:21
Citric acid-2,4-13C2 structure
|
Common Name | Citric acid-2,4-13C2 | ||
|---|---|---|---|---|
| CAS Number | 121633-50-9 | Molecular Weight | 194.10900 | |
| Density | 1.762g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H8O7 | Melting Point | 153-159ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
Use of Citric acid-2,4-13C2Citric acid-2,4-13C2 (Sodium Lauryl Sulfate) is a labeled citric acid. Citric acid is found in many fruits and vegetables, especially citrus fruits. It participates in biological processes in the body, such as the citric acid cycle. |
| Name | 2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Citric acid-2,4-13C2 (Sodium Lauryl Sulfate) is a labeled citric acid. Citric acid is found in many fruits and vegetables, especially citrus fruits. It participates in biological processes in the body, such as the citric acid cycle. |
|---|---|
| Related Catalog |
| Density | 1.762g/cm3 |
|---|---|
| Melting Point | 153-159ºC(lit.) |
| Molecular Formula | C6H8O7 |
| Molecular Weight | 194.10900 |
| Exact Mass | 194.03400 |
| PSA | 132.13000 |
| Index of Refraction | 1.575 |
| InChIKey | KRKNYBCHXYNGOX-ZDOIIHCHSA-N |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 37/38-41 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| CITRIC ACID-[2,4-13C2] |
| MFCD00143997 |
| [13C2,13C4]citric acid |
| CITRIC ACID-2,4-13C2 |
| 2,4-(13)C citric acid |
| (2,4-13C2)citric acid |
| citric acid-2,4-13C |
| CITRIC-2,4-13C2 ACID |
| CITRIC-2 4-13C2 ACID |