3-O-p-Coumaroyltormentic acid
Modify Date: 2025-08-25 19:44:29
3-O-p-Coumaroyltormentic acid structure
|
Common Name | 3-O-p-Coumaroyltormentic acid | ||
|---|---|---|---|---|
| CAS Number | 121064-78-6 | Molecular Weight | 634.842 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 745.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C39H54O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.5±26.4 °C | |
Use of 3-O-p-Coumaroyltormentic acid3-O-trans-p-Coumaroyltormentic acid is a triterpene having no cytotoxic activity. However, 3-O-cris-p-Coumaroyltormentic acid is a cytotoxic triterpene, can be isolated from the methanol extract of Goreishi (the feces of Trogopterus xanthipes Milne-Edwards)[1]. |
| Name | 3-O-trans-p-Coumaroyltormentic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3-O-trans-p-Coumaroyltormentic acid is a triterpene having no cytotoxic activity. However, 3-O-cris-p-Coumaroyltormentic acid is a cytotoxic triterpene, can be isolated from the methanol extract of Goreishi (the feces of Trogopterus xanthipes Milne-Edwards)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 745.5±60.0 °C at 760 mmHg |
| Molecular Formula | C39H54O7 |
| Molecular Weight | 634.842 |
| Flash Point | 224.5±26.4 °C |
| Exact Mass | 634.386963 |
| PSA | 124.29000 |
| LogP | 8.19 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | BZORLJPADUHVJE-YNCXRGRLSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(OC(=O)C=Cc6ccc(O)cc6)C(C)(C)C5CCC43C)C2C1(C)O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:7400-08-0
CAS#:13850-16-3| (2α,3β)-2,19-Dihydroxy-3-{[(2E)-3-(4-hydroxyphenyl)-2-propenoyl]oxy}urs-12-en-28-oic acid |
| Urs-12-en-28-oic acid, 2,19-dihydroxy-3-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-, (2α,3β)- |