(-)-Jasmonoyl-L-isoleucine
Modify Date: 2025-08-26 19:35:16
(-)-Jasmonoyl-L-isoleucine structure
|
Common Name | (-)-Jasmonoyl-L-isoleucine | ||
|---|---|---|---|---|
| CAS Number | 120330-93-0 | Molecular Weight | 323.42700 | |
| Density | 1.064g/cm3 | Boiling Point | 527.5ºC at 760 mmHg | |
| Molecular Formula | C18H29NO4 | Melting Point | 118 - 121°C (lit.) | |
| MSDS | N/A | Flash Point | 272.8ºC | |
Use of (-)-Jasmonoyl-L-isoleucine(-)-Jasmonoyl-L-isoleucine ((-)-JA-L-Ile) is an inactive endogenous hormone. (-)-Jasmonoyl-L-isoleucine is an enantiomer of (+)-JA-L-Ile[1]. |
| Name | (2S,3S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Jasmonoyl-L-isoleucine ((-)-JA-L-Ile) is an inactive endogenous hormone. (-)-Jasmonoyl-L-isoleucine is an enantiomer of (+)-JA-L-Ile[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 527.5ºC at 760 mmHg |
| Melting Point | 118 - 121°C (lit.) |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.42700 |
| Flash Point | 272.8ºC |
| Exact Mass | 323.21000 |
| PSA | 86.96000 |
| LogP | 3.78390 |
| Vapour Pressure | 1.54E-12mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | IBZYPBGPOGJMBF-QRHMYKSGSA-N |
| SMILES | CCC=CCC1C(=O)CCC1CC(=O)NC(C(=O)O)C(C)CC |
| CMC_7385 |
| Jasmonate-isoleucine conjugate |