Sodium 3-methyl-2-oxobutanoate-13C,d4 structure
|
Common Name | Sodium 3-methyl-2-oxobutanoate-13C,d4 | ||
|---|---|---|---|---|
| CAS Number | 1202865-40-4 | Molecular Weight | 139.09000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H7NaO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Sodium 3-methyl-2-oxobutanoate-13C,d4Sodium 3-methyl-2-oxobutanoate-13C,d4 is the deuterium and 13C labeled Sodium 3-methyl-2-oxobutanoate[1]. Sodium 3-methyl-2-oxobutanoate is a precursor of pantothenic acid in Escherichia coli[2][3][4]. |
| Name | sodium,3-methyl-2-oxobutanoate |
|---|
| Description | Sodium 3-methyl-2-oxobutanoate-13C,d4 is the deuterium and 13C labeled Sodium 3-methyl-2-oxobutanoate[1]. Sodium 3-methyl-2-oxobutanoate is a precursor of pantothenic acid in Escherichia coli[2][3][4]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C5H7NaO3 |
|---|---|
| Molecular Weight | 139.09000 |
| Exact Mass | 139.03300 |
| PSA | 57.20000 |
| InChIKey | WIQBZDCJCRFGKA-YTBWXGASSA-M |
| SMILES | CC(C)C(=O)C(=O)[O-].[Na+] |