Dexloxiglumide structure
|
Common Name | Dexloxiglumide | ||
|---|---|---|---|---|
| CAS Number | 119817-90-2 | Molecular Weight | 461.37900 | |
| Density | 1.233g/cm3 | Boiling Point | 632.2ºC at 760mmHg | |
| Molecular Formula | C21H30Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.1ºC | |
Use of DexloxiglumideDexloxiglumide is a selective cholecystokinin type A (CCKA) receptor antagonist[1]. Dexloxiglumide, the active enantiomer of Loxiglumide, inhibits smooth muscle cell contractions induced by cholecystokinin-octapeptide (CCK-8)[2]. |
| Name | (4R)-4-[(3,4-dichlorobenzoyl)amino]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Dexloxiglumide is a selective cholecystokinin type A (CCKA) receptor antagonist[1]. Dexloxiglumide, the active enantiomer of Loxiglumide, inhibits smooth muscle cell contractions induced by cholecystokinin-octapeptide (CCK-8)[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 632.2ºC at 760mmHg |
| Molecular Formula | C21H30Cl2N2O5 |
| Molecular Weight | 461.37900 |
| Flash Point | 336.1ºC |
| Exact Mass | 460.15300 |
| PSA | 95.94000 |
| LogP | 4.40280 |
| Vapour Pressure | 7.51E-17mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | QNQZBKQEIFTHFZ-GOSISDBHSA-N |
| SMILES | CCCCCN(CCCOC)C(=O)C(CCC(=O)O)NC(=O)c1ccc(Cl)c(Cl)c1 |
| Hazard Codes | Xn,Xi |
|---|
| CR-2017 |
| Dexloxiglumida [INN-Spanish] |
| Dexloxiglumidum [INN-Latin] |
| Dexloxiglumidum |
| Dexloxiglumida |
| Dexloxiglumide |