CRANAD-2
Modify Date: 2025-08-25 16:51:15
CRANAD-2 structure
|
Common Name | CRANAD-2 | ||
|---|---|---|---|---|
| CAS Number | 1193447-34-5 | Molecular Weight | 410.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H25BF2N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of CRANAD-2CRANAD-2 is a near-infrared (NIR) Aβ plaque-specific fluorescent probe. CRANAD 2 penetrates the blood brain barrier and has a high affinity for Aβ aggregates with a Kd of 38 nM[1][2]. |
| Name | CRANAD-2 |
|---|---|
| Synonym | More Synonyms |
| Description | CRANAD-2 is a near-infrared (NIR) Aβ plaque-specific fluorescent probe. CRANAD 2 penetrates the blood brain barrier and has a high affinity for Aβ aggregates with a Kd of 38 nM[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H25BF2N2O2 |
|---|---|
| Molecular Weight | 410.26500 |
| Exact Mass | 410.19800 |
| PSA | 32.78000 |
| LogP | 4.93870 |
| InChIKey | PVXQJYXODFZTBR-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=CC2=CC(=CC=C3C=CC(=[N+](C)C)C=C3)O[B-](F)(F)O2)cc1 |
| Storage condition | 2-8°C |
| Water Solubility | DMSO: soluble 0.2 mg/mL, clear (warmed) |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| (T-4)-[(1E,6E)-1,7-bis[4-(dimethylamino)phenyl]-1,6-heptadiene-3,5-dionato-kO3,kO5]difluoro-boron |