Cassiaside B
Modify Date: 2025-08-21 07:27:39
Cassiaside B structure
|
Common Name | Cassiaside B | ||
|---|---|---|---|---|
| CAS Number | 119170-51-3 | Molecular Weight | 566.50800 | |
| Density | N/A | Boiling Point | 889.4±65.0 °C(Predicted) | |
| Molecular Formula | C26H30O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cassiaside BCassiaside B, a naphthopyrone, has potent antimicrobial activity[1]. |
| Name | rubrofusarin-6-O-β-D-apiofuranosyl(1->6)-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Cassiaside B, a naphthopyrone, has potent antimicrobial activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Cassiaside B is against Acinetobacter sp. with a MIC of 10 μg/mL[1]. |
| References |
| Boiling Point | 889.4±65.0 °C(Predicted) |
|---|---|
| Molecular Formula | C26H30O14 |
| Molecular Weight | 566.50800 |
| Exact Mass | 566.16400 |
| PSA | 217.97000 |
| InChIKey | NIVCJAYDAMQSJO-ZWRRHSGTSA-N |
| SMILES | COc1cc(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O)c2c(O)c3c(=O)cc(C)oc3cc2c1 |
| Hazard Codes | Xi |
|---|
| rubrofusarin-6-O-β-D-apiofuranosyl-(1-6)-O-β-D-glucopyranoside |
| cassiaside B |
| 6-[(2S,3R,4S,5S,6R)-6-((2R,3R,4R)-3,4-Dihydroxy-4-hydroxymethyl-tetrahydro-furan-2-yloxymethyl)-3,4,5-trihydroxy-tetrahydro-pyran-2-yloxy]-5-hydroxy-8-methoxy-2-methyl-benzo[g]chromen-4-one |