Naratriptan (D3 Hydrochloride)
Modify Date: 2025-11-25 07:50:18
Naratriptan (D3 Hydrochloride) structure
|
Common Name | Naratriptan (D3 Hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 1190021-64-7 | Molecular Weight | 374.94 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23D3ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Naratriptan (D3 Hydrochloride)Naratriptan D3 Hydrochloride is the deuterium labeled Naratriptan, which is a selective 5-HT1 receptor subtype agonist. |
| Name | N-methyl-2-[3-[1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-5-yl]ethanesulfonamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Naratriptan D3 Hydrochloride is the deuterium labeled Naratriptan, which is a selective 5-HT1 receptor subtype agonist. |
|---|---|
| Related Catalog |
| Molecular Formula | C17H23D3ClN3O2S |
|---|---|
| Molecular Weight | 374.94 |
| PSA | 73.58000 |
| LogP | 4.28040 |
| InChIKey | AWEZYKMQFAUBTD-MUTAZJQDSA-N |
| SMILES | CNS(=O)(=O)CCc1ccc2[nH]cc(C3CCN(C)CC3)c2c1.Cl |
| Storage condition | 2-8℃ |
| Naramig-d3 |
| Naratriptan Hydrochloride-Labeled d3 |
| Amerge-d3. |
| Naratriptan-d3 Hydrochloride |
| Naratriptan (D3 Hydrochloride) |