KN-93 Phosphate
Modify Date: 2025-09-17 18:27:23
KN-93 Phosphate structure
|
Common Name | KN-93 Phosphate | ||
|---|---|---|---|---|
| CAS Number | 1188890-41-6 | Molecular Weight | 599.03300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H32ClN2O8PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KN-93 PhosphateKN-93 is a selective inhibitor of Ca2+/calmodulin-dependent kinase II (CaMKII), competitively blocking CaM binding to the kinase (Ki = 370 nM). |
| Name | N-(2-{[[(2E)-3-(4-chlorophenyl)prop-2-enyl](methyl)amino]methyl}phenyl)-N-(2-hydroxyethyl)-4-methoxybenzenesulfonamide phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H32ClN2O8PS |
|---|---|
| Molecular Weight | 599.03300 |
| Exact Mass | 598.13100 |
| PSA | 166.03000 |
| LogP | 4.83360 |
| InChIKey | NNKJTPOXLIILMB-IPZCTEOASA-N |
| SMILES | COc1ccc(S(=O)(=O)N(CCO)c2ccccc2CN(C)CC=Cc2ccc(Cl)cc2)cc1.O=P(O)(O)O |
| Storage condition | -20℃ |
| KN-93 Phosphate |