6-Cyclopropylmethoxy-6-deaminomitomycin C
Modify Date: 2025-09-19 14:45:21
6-Cyclopropylmethoxy-6-deaminomitomycin C structure
|
Common Name | 6-Cyclopropylmethoxy-6-deaminomitomycin C | ||
|---|---|---|---|---|
| CAS Number | 118598-79-1 | Molecular Weight | 389.40200 | |
| Density | 1.48g/cm3 | Boiling Point | 623.6ºC at 760 mmHg | |
| Molecular Formula | C19H23N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.9ºC | |
| Name | 6-Cyclopropylmethoxy-6-deaminomitomycin C |
|---|
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 623.6ºC at 760 mmHg |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.40200 |
| Flash Point | 330.9ºC |
| Exact Mass | 389.15900 |
| PSA | 131.09000 |
| LogP | 0.59720 |
| Vapour Pressure | 1.8E-15mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | ULWXQENCZOSGIK-HSVDZBDXSA-N |
| SMILES | COC12C(COC(N)=O)C3=C(C(=O)C(C)=C(OCC4CC4)C3=O)N1CC1NC12 |
|
~62%
6-Cyclopropylme... CAS#:118598-79-1 |
| Literature: Sami; Remers; Bradner Journal of Medicinal Chemistry, 1989 , vol. 32, # 3 p. 703 - 708 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |