6,6-dibutylstannepino[4,5-c]thiophene structure
|
Common Name | 6,6-dibutylstannepino[4,5-c]thiophene | ||
|---|---|---|---|---|
| CAS Number | 138354-61-7 | Molecular Weight | 368.13600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25SSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,6-dibutylstannepino[4,5-c]thiophene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H25SSn |
|---|---|
| Molecular Weight | 368.13600 |
| Exact Mass | 369.07000 |
| PSA | 28.24000 |
| LogP | 5.77150 |
| InChIKey | NWHROVGVEKRVNN-UHFFFAOYSA-N |
| SMILES | CCCC[Sn]1(CCCC)C=Cc2cscc2C=C1 |
|
~82%
6,6-dibutylstan... CAS#:138354-61-7 |
| Literature: Sugihara, Yoshikazu; Yagi, Toshiyasu; Murata, Ichiro Journal of the American Chemical Society, 1992 , vol. 114, p. 1479 - 1481 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6H-Stannepino[4,5-c]thiophene,6,6-dibutyl |